Chemical Component Summary | |
|---|---|
| Name | CORTICOSTERONE |
| Identifiers | (8S,9S,10R,11S,13S,14S,17S)-11-hydroxy-17-(2-hydroxyethanoyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| Formula | C21 H30 O4 |
| Molecular Weight | 346.46 |
| Type | NON-POLYMER |
| Isomeric SMILES | C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(=O)CC[C@]34C)[C@@H]1CC[C@@H]2C(=O)CO |
| InChI | InChI=1S/C21H30O4/c1-20-8-7-13(23)9-12(20)3-4-14-15-5-6-16(18(25)11-22)21(15,2)10-17(24)19(14)20/h9,14-17,19,22,24H,3-8,10-11H2,1-2H3/t14-,15-,16+,17-,19+,20-,21-/m0/s1 |
| InChIKey | OMFXVFTZEKFJBZ-HJTSIMOOSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 55 |
| Chiral Atom Count | 7 |
| Chiral Atoms | C10, C11, C13, C14, C17, C8, C9 |
| Bond Count | 58 |
| Aromatic Bond Count | 0 |
| Leaving Atoms | n/a |
Drug Info: DrugBank
| DrugBank ID | DB04652 Different stereochemistry |
|---|---|
| Name | (11-BETA)-11,21-DIHYDROXY-PREGN-4-ENE-3,20-DIONE |
| Groups | experimental |
| Description | An adrenocortical steroid that has modest but significant activities as a mineralocorticoid and a glucocorticoid. (From Goodman and Gilman's The Pharmacological Basis of Therapeutics, 8th ed, p1437) |
Drug Targets
| Name | Sequence Search | Pharmacological Action | Actions |
|---|---|---|---|
| Corticosteroid 11-beta-dehydrogenase isozyme 1 | MAFMKKYLLPILGLFMAYYYYSANEEFRPEMLQGKKVIVTGASKGIGREM... | unknown | |
| Nuclear receptor coactivator 1 | MSGLGDSSSDPANPDSHKRKGSPCDTLASSTEKRRREQENKYLEELAELL... | unknown | |
| Mineralocorticoid receptor | METKGYHSLPEGLDMERRWGQVSQAVERSSLGPTERTDENNYMEIVNVSC... | unknown |
Drug Info/Drug Targets: DrugBank 3.0: a comprehensive resource for 'omics' research on drugs. Knox C, Law V, Jewison
T, Liu P, Ly S, Frolkis A, Pon A, Banco K, Mak C, Neveu V, Djoumbou Y, Eisner R, Guo AC, Wishart DS.
Nucleic Acids Res. 2011 Jan; 39 (Database issue):D1035-41. | PMID:21059682
