Chemical Component Summary | |
|---|---|
| Name | N-METHYLMESOPORPHYRIN |
| Identifiers | n/a |
| Formula | C35 H40 N4 O4 |
| Molecular Weight | 580.716 |
| Type | NON-POLYMER |
| Isomeric SMILES | CCc1c(c2cc3nc(\cc/4\c(c(/c(/[nH]4)c/c5n/c(c\c1n2C)/C(=C5CC)C)C)CCC(=O)O)C(=C3C)CCC(=O)O)C |
| InChI | InChI=1S/C35H40N4O4/c1-8-22-18(3)28-17-33-23(9-2)21(6)32(39(33)7)16-27-20(5)25(11-13-35(42)43)31(38-27)15-30-24(10-12-34(40)41)19(4)26(36-30)14-29(22)37-28/h14-17,36H,8-13H2,1-7H3,(H,40,41)(H,42,43)/b26-14-,27-16-,28-17-,29-14-,30-15-,31-15-,32-16-,33-17- |
| InChIKey | YNWHQWMCLCANDI-YIYRCNGCSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 83 |
| Chiral Atom Count | 0 |
| Bond Count | 87 |
| Aromatic Bond Count | 22 |
Drug Info: DrugBank
| DrugBank ID | DB01911 |
|---|---|
| Name | N-Methylmesoporphyrin |
| Groups | experimental |
| Description | N-methylmesoporphyrin is a solid. This compound belongs to the porphyrins. These are compounds containing a fundamental skeleton of four pyrrole nuclei united through the alpha-positions by four methine groups to form a macrocyclic structure. This medication is known to target ferrochelatase. |
| Synonyms | N-Methylmesoporphyrin |
| Categories |
|
| CAS number | 142234-85-3 |
Drug Targets
| Name | Target Sequence | Pharmacological Action | Actions |
|---|---|---|---|
| Ferrochelatase | MSRKKMGLLVMAYGTPYKEEDIERYYTHIRRGRKPEPEMLQDLKDRYEAI... | unknown |
Drug Info/Drug Targets: DrugBank 3.0: a comprehensive resource for 'omics' research on drugs. Knox C, Law V, Jewison
T, Liu P, Ly S, Frolkis A, Pon A, Banco K, Mak C, Neveu V, Djoumbou Y, Eisner R, Guo AC, Wishart DS.
Nucleic Acids Res. 2011 Jan; 39 (Database issue):D1035-41. | PMID:21059682
