Chemical Component Summary | |
|---|---|
| Name | PROFLAVIN |
| Identifiers | acridine-3,6-diamine |
| Formula | C13 H11 N3 |
| Molecular Weight | 209.25 |
| Type | NON-POLYMER |
| Isomeric SMILES | Nc1ccc2cc3ccc(N)cc3nc2c1 |
| InChI | InChI=1S/C13H11N3/c14-10-3-1-8-5-9-2-4-11(15)7-13(9)16-12(8)6-10/h1-7H,14-15H2 |
| InChIKey | WDVSHHCDHLJJJR-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 27 |
| Chiral Atom Count | 0 |
| Chiral Atoms | n/a |
| Bond Count | 29 |
| Aromatic Bond Count | 16 |
| Leaving Atoms | n/a |
Drug Info: DrugBank
| DrugBank ID | DB01123 Different stereochemistry |
|---|---|
| Name | Proflavine |
| Groups | approved |
| Description | 3,6-Diaminoacridine. Topical antiseptic used mainly in wound dressings. [PubChem] |
| Synonyms |
|
| Salts | Proflavine hemisulfate |
| Brand Names |
|
| Affected Organism | Enteric bacteria and other eubacteria |
| Indication | Topical antiseptic used mainly in wound dressings. |
| Pharmacology | Proflavine is an acriflavine derivative which is a disinfectant bacteriostatic against many gram-positive bacteria. Proflavine is toxic and carcinogenic in mammals and so it is used only as a surface disinfectant or for treating superficial wounds. |
| Mechanism of action | Proflavine acts by interchelating DNA (intercalation), thereby disrupting DNA synthesis and leading to high levels of mutation in the copied DNA strands. This prevents bacterial reproduction. |
| Route of administration | Topical |
| Categories |
|
| CAS number | 92-62-6 |
Drug Targets
| Name | Sequence Search | Pharmacological Action | Actions |
|---|---|---|---|
| Prothrombin | MAHVRGLQLPGCLALAALCSLVHSQHVFLAPQQARSLLQRVRRANTFLEE... | no | other/unknown |
| HTH-type transcriptional regulator QacR | MNLKDKILGVAKELFIKNGYNATTTGEIVKLSESSKGNLYYHFKTKENLF... | unknown | |
| TetR family transcriptional regulator | MTSPSIESGARERTRRAILDAAMLVLADHPTAALGDIAAAAGVGRSTVHR... | unknown | |
| yes | intercalation |
Drug Info/Drug Targets: DrugBank 3.0: a comprehensive resource for 'omics' research on drugs. Knox C, Law V, Jewison
T, Liu P, Ly S, Frolkis A, Pon A, Banco K, Mak C, Neveu V, Djoumbou Y, Eisner R, Guo AC, Wishart DS.
Nucleic Acids Res. 2011 Jan; 39 (Database issue):D1035-41. | PMID:21059682
