Chemical Component Summary | |
|---|---|
| Name | Zosuquidar |
| Formula | C32 H31 F2 N3 O2 |
| Molecular Weight | 527.604 |
| Type | NON-POLYMER |
| Isomeric SMILES | c1ccc2c(c1)[C@@H]3[C@@H](C3(F)F)c4ccccc4C2N5CCN(CC5)C[C@H](COc6cccc7c6cccn7)O |
| InChI | InChI=1S/C32H31F2N3O2/c33-32(34)29-22-7-1-3-9-24(22)31(25-10-4-2-8-23(25)30(29)32)37-17-15-36(16-18-37)19-21(38)20-39-28-13-5-12-27-26(28)11-6-14-35-27/h1-14,21,29-31,38H,15-20H2/t21-,29-,30+,31-/m1/s1 |
| InChIKey | IHOVFYSQUDPMCN-DBEBIPAYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 70 |
| Chiral Atom Count | 3 |
| Bond Count | 76 |
| Aromatic Bond Count | 23 |
Drug Info: DrugBank
| DrugBank ID | DB06191 |
|---|---|
| Name | Zosuquidar |
| Groups | investigational |
| Description | Zosuquidar is a compound of antineoplastic drug candidates currently under development. It is now in "Phase 3" of clinical tests in the United States. Its action mechanism consists of the inhibition of P-glycoproteins; other drugs with this mechanism include tariquidar and laniquidar. |
| Synonyms |
|
| Indication | Investigated for use/treatment in leukemia (myeloid) and myelodysplastic syndrome. |
| Categories |
|
| CAS number | 167354-41-8 |
Drug Targets
| Name | Target Sequence | Pharmacological Action | Actions |
|---|---|---|---|
| P-glycoprotein 1 | MDLEGDRNGGAKKKNFFKLNNKSEKDKKEKKPTVSVFSMFRYSNWLDKLY... | unknown | inhibitor |
Drug Info/Drug Targets: DrugBank 3.0: a comprehensive resource for 'omics' research on drugs. Knox C, Law V, Jewison
T, Liu P, Ly S, Frolkis A, Pon A, Banco K, Mak C, Neveu V, Djoumbou Y, Eisner R, Guo AC, Wishart DS.
Nucleic Acids Res. 2011 Jan; 39 (Database issue):D1035-41. | PMID:21059682
